C16H21F7NO7S- — CID 140614459
4-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate (PubChem CID 140614459) has the molecular formula C16H21F7NO7S- and a molecular weight of 504.40 g/mol. Its IUPAC name is 4-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate.
| Compound Name | 4-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 140614459 |
| Molecular Formula | C16H21F7NO7S- |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 4-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
| SMILES | C=CC(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)N(CCC)CCC)C(F)(F)F |
| InChI | InChI=1S/C16H22F7NO7S/c1-4-8-24(9-5-2)12(26)14(15(19,20)21,31-11(25)6-3)30-10-7-13(17,18)16(22,23)32(27,28)29/h6H,3-5,7-10H2,1-2H3,(H,27,28,29)/p-1 |
| InChIKey | UDHBZRDJBVBBSD-UHFFFAOYSA-M |
| XLogP | 2.80 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|