C13H14F7O8S- — CID 140614440
5-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluoropentane-1-sulfonate (PubChem CID 140614440) has the molecular formula C13H14F7O8S- and a molecular weight of 463.30 g/mol. Its IUPAC name is 5-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluoropentane-1-sulfonate.
| Compound Name | 5-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 140614440 |
| Molecular Formula | C13H14F7O8S- |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 5-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluoropentane-1-sulfonate |
| SMILES | C=CC(=O)OC(OCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C13H15F7O8S/c1-3-8(21)28-11(12(16,17)18,9(22)26-4-2)27-7-5-6-10(14,15)13(19,20)29(23,24)25/h3H,1,4-7H2,2H3,(H,23,24,25)/p-1 |
| InChIKey | XIACZJLNCFGDFS-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|