C14H17F7O8S — CID 140614582
6-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluorohexane-1-sulfonic acid (PubChem CID 140614582) has the molecular formula C14H17F7O8S and a molecular weight of 478.34 g/mol. Its IUPAC name is 6-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluorohexane-1-sulfonic acid.
| Compound Name | 6-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluorohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 140614582 |
| Molecular Formula | C14H17F7O8S |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 6-(3-ethoxy-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl)oxy-1,1,2,2-tetrafluorohexane-1-sulfonic acid |
| SMILES | C=CC(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C14H17F7O8S/c1-3-9(22)29-12(13(17,18)19,10(23)27-4-2)28-8-6-5-7-11(15,16)14(20,21)30(24,25)26/h3H,1,4-8H2,2H3,(H,24,25,26) |
| InChIKey | FIAIFCQKOUWVHJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|