C19H19F7O7S — CID 161369056
1,1,2,2-tetrafluoro-6-(1,1,1-trifluoro-3-oxo-4-phenyl-2-prop-2-enoyloxybutan-2-yl)oxyhexane-1-sulfonic acid (PubChem CID 161369056) has the molecular formula C19H19F7O7S and a molecular weight of 524.41 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-(1,1,1-trifluoro-3-oxo-4-phenyl-2-prop-2-enoyloxybutan-2-yl)oxyhexane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-6-(1,1,1-trifluoro-3-oxo-4-phenyl-2-prop-2-enoyloxybutan-2-yl)oxyhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 161369056 |
| Molecular Formula | C19H19F7O7S |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-(1,1,1-trifluoro-3-oxo-4-phenyl-2-prop-2-enoyloxybutan-2-yl)oxyhexane-1-sulfonic acid |
| SMILES | C=CC(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H19F7O7S/c1-2-15(28)33-17(18(22,23)24,14(27)12-13-8-4-3-5-9-13)32-11-7-6-10-16(20,21)19(25,26)34(29,30)31/h2-5,8-9H,1,6-7,10-12H2,(H,29,30,31) |
| InChIKey | SHCIOWPSTNJBCU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|