C16H21F8NO7S — CID 140614249
1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-(2-methylpropylamino)-3-oxopropan-2-yl]oxyhexane-1-sulfonic acid (PubChem CID 140614249) has the molecular formula C16H21F8NO7S and a molecular weight of 523.40 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-(2-methylpropylamino)-3-oxopropan-2-yl]oxyhexane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-(2-methylpropylamino)-3-oxopropan-2-yl]oxyhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 140614249 |
| Molecular Formula | C16H21F8NO7S |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-(2-methylpropylamino)-3-oxopropan-2-yl]oxyhexane-1-sulfonic acid |
| SMILES | C=C(F)C(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)NCC(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H21F8NO7S/c1-9(2)8-25-12(27)14(15(20,21)22,32-11(26)10(3)17)31-7-5-4-6-13(18,19)16(23,24)33(28,29)30/h9H,3-8H2,1-2H3,(H,25,27)(H,28,29,30) |
| InChIKey | JUFPDDLJSQARQY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|