C15H18F8O8S — CID 140614622
1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonic acid (PubChem CID 140614622) has the molecular formula C15H18F8O8S and a molecular weight of 510.35 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 140614622 |
| Molecular Formula | C15H18F8O8S |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-propoxypropan-2-yl]oxyhexane-1-sulfonic acid |
| SMILES | C=C(F)C(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)OCCC)C(F)(F)F |
| InChI | InChI=1S/C15H18F8O8S/c1-3-7-29-11(25)13(14(19,20)21,31-10(24)9(2)16)30-8-5-4-6-12(17,18)15(22,23)32(26,27)28/h2-8H2,1H3,(H,26,27,28) |
| InChIKey | KYKGCKHNPZCDSS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|