C13H13F8NO8S — CID 140614716
1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(2-oxopropylamino)propan-2-yl]oxybutane-1-sulfonic acid (PubChem CID 140614716) has the molecular formula C13H13F8NO8S and a molecular weight of 495.30 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(2-oxopropylamino)propan-2-yl]oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(2-oxopropylamino)propan-2-yl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 140614716 |
| Molecular Formula | C13H13F8NO8S |
| Molecular Weight | 495.30 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxo-3-(2-oxopropylamino)propan-2-yl]oxybutane-1-sulfonic acid |
| SMILES | C=C(F)C(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)NCC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C13H13F8NO8S/c1-6(23)5-22-9(25)11(12(17,18)19,30-8(24)7(2)14)29-4-3-10(15,16)13(20,21)31(26,27)28/h2-5H2,1H3,(H,22,25)(H,26,27,28) |
| InChIKey | AOSUWEYPOWTXDQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|