C13H16F5NO5S — CID 88551658
[2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(2-oxopropylamino)propan-2-yl] 2-methylprop-2-enoate (PubChem CID 88551658) has the molecular formula C13H16F5NO5S and a molecular weight of 393.33 g/mol. Its IUPAC name is [2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(2-oxopropylamino)propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(2-oxopropylamino)propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88551658 |
| Molecular Formula | C13H16F5NO5S |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | [2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(2-oxopropylamino)propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OCCC(F)(F)S)(C(=O)NCC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F5NO5S/c1-7(2)9(21)24-12(13(16,17)18,10(22)19-6-8(3)20)23-5-4-11(14,15)25/h25H,1,4-6H2,2-3H3,(H,19,22) |
| InChIKey | GNUQHJQJYLOLBX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|