C11H13F5NO7S- — CID 140614477
2-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate (PubChem CID 140614477) has the molecular formula C11H13F5NO7S- and a molecular weight of 398.28 g/mol. Its IUPAC name is 2-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 140614477 |
| Molecular Formula | C11H13F5NO7S- |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoroethanesulfonate |
| SMILES | C=C(C)C(=O)OC(OCC(F)(F)S(=O)(=O)[O-])(C(=O)NCC)C(F)(F)F |
| InChI | InChI=1S/C11H14F5NO7S/c1-4-17-8(19)10(11(14,15)16,24-7(18)6(2)3)23-5-9(12,13)25(20,21)22/h2,4-5H2,1,3H3,(H,17,19)(H,20,21,22)/p-1 |
| InChIKey | FFJRVKVFMMLXQY-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|