C12H9F8O9S- — CID 140614479
1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate (PubChem CID 140614479) has the molecular formula C12H9F8O9S- and a molecular weight of 481.25 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate |
|---|---|
| PubChem CID | 140614479 |
| Molecular Formula | C12H9F8O9S- |
| Molecular Weight | 481.25 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonate |
| SMILES | C=C(C(=O)OC(OCC(F)(F)S(=O)(=O)[O-])(C(=O)OCC(C)=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F8O9S/c1-5(21)3-27-8(23)10(12(18,19)20,28-4-9(13,14)30(24,25)26)29-7(22)6(2)11(15,16)17/h2-4H2,1H3,(H,24,25,26)/p-1 |
| InChIKey | OJTJDRPASQYHOT-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|