C13H14F8O8S — CID 140614168
1,1-difluoro-2-[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonic acid (PubChem CID 140614168) has the molecular formula C13H14F8O8S and a molecular weight of 482.30 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 140614168 |
| Molecular Formula | C13H14F8O8S |
| Molecular Weight | 482.30 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 1,1-difluoro-2-[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyethanesulfonic acid |
| SMILES | C=C(C(=O)OC(OCC(F)(F)S(=O)(=O)O)(C(=O)OC(C)(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H14F8O8S/c1-6(12(16,17)18)7(22)28-11(13(19,20)21,8(23)29-9(2,3)4)27-5-10(14,15)30(24,25)26/h1,5H2,2-4H3,(H,24,25,26) |
| InChIKey | QXYFYOKGZXJOOR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|