C6H12F2O4S — CID 129070340
1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]ethanesulfonic acid (PubChem CID 129070340) has the molecular formula C6H12F2O4S and a molecular weight of 218.22 g/mol. Its IUPAC name is 1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 129070340 |
| Molecular Formula | C6H12F2O4S |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 1,1-difluoro-2-[(2-methylpropan-2-yl)oxy]ethanesulfonic acid |
| SMILES | CC(C)(C)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C6H12F2O4S/c1-5(2,3)12-4-6(7,8)13(9,10)11/h4H2,1-3H3,(H,9,10,11) |
| InChIKey | FDNUQPVOOPMMCL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|