C7H10F2O5S — CID 129070614
1,1-difluoro-2-[(E)-pent-2-enoyl]oxyethanesulfonic acid (PubChem CID 129070614) has the molecular formula C7H10F2O5S and a molecular weight of 244.21 g/mol. Its IUPAC name is 1,1-difluoro-2-[(E)-pent-2-enoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(E)-pent-2-enoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 129070614 |
| Molecular Formula | C7H10F2O5S |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 1,1-difluoro-2-[(E)-pent-2-enoyl]oxyethanesulfonic acid |
| SMILES | CC/C=C/C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C7H10F2O5S/c1-2-3-4-6(10)14-5-7(8,9)15(11,12)13/h3-4H,2,5H2,1H3,(H,11,12,13)/b4-3+ |
| InChIKey | BEWGTBXMGZTYGY-ONEGZZNKSA-N |
| XLogP | 0.98 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|