C8H8F4O7S — CID 87451250
1,1,2,2-tetrafluoro-3-[(Z)-4-methoxy-4-oxobut-2-enoyl]oxypropane-1-sulfonic acid (PubChem CID 87451250) has the molecular formula C8H8F4O7S and a molecular weight of 324.20 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-[(Z)-4-methoxy-4-oxobut-2-enoyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-3-[(Z)-4-methoxy-4-oxobut-2-enoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87451250 |
| Molecular Formula | C8H8F4O7S |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-[(Z)-4-methoxy-4-oxobut-2-enoyl]oxypropane-1-sulfonic acid |
| SMILES | COC(=O)/C=C\C(=O)OCC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H8F4O7S/c1-18-5(13)2-3-6(14)19-4-7(9,10)8(11,12)20(15,16)17/h2-3H,4H2,1H3,(H,15,16,17)/b3-2- |
| InChIKey | VQQDHDFFEOYJOG-IHWYPQMZSA-N |
| XLogP | 0.37 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|