C10H12F4O4 — CID 154119154
4-oxo-4-(2,2,3,3-tetrafluoro-4-methylpentoxy)but-2-enoic acid (PubChem CID 154119154) has the molecular formula C10H12F4O4 and a molecular weight of 272.19 g/mol. Its IUPAC name is 4-oxo-4-(2,2,3,3-tetrafluoro-4-methylpentoxy)but-2-enoic acid.
| Compound Name | 4-oxo-4-(2,2,3,3-tetrafluoro-4-methylpentoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 154119154 |
| Molecular Formula | C10H12F4O4 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-oxo-4-(2,2,3,3-tetrafluoro-4-methylpentoxy)but-2-enoic acid |
| SMILES | CC(C)C(F)(F)C(F)(F)COC(=O)C=CC(=O)O |
| InChI | InChI=1S/C10H12F4O4/c1-6(2)10(13,14)9(11,12)5-18-8(17)4-3-7(15)16/h3-4,6H,5H2,1-2H3,(H,15,16) |
| InChIKey | WIJFSCDPCHRVPP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|