C11H18O6 — CID 54331608
4-(3,3-dimethoxy-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid (PubChem CID 54331608) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 4-(3,3-dimethoxy-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid.
| Compound Name | 4-(3,3-dimethoxy-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54331608 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-(3,3-dimethoxy-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid |
| SMILES | COC(OC)C(C)(C)COC(=O)C=CC(=O)O |
| InChI | InChI=1S/C11H18O6/c1-11(2,10(15-3)16-4)7-17-9(14)6-5-8(12)13/h5-6,10H,7H2,1-4H3,(H,12,13) |
| InChIKey | SYSYRCCYJOQKPS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|