C13H19NO8 — CID 122667342
2-[[(2R)-2-hydroxy-4-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3,3-dimethylbutanoyl]amino]acetic acid (PubChem CID 122667342) has the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[[(2R)-2-hydroxy-4-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3,3-dimethylbutanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-hydroxy-4-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3,3-dimethylbutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 122667342 |
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-[[(2R)-2-hydroxy-4-[(E)-4-methoxy-4-oxobut-2-enoyl]oxy-3,3-dimethylbutanoyl]amino]acetic acid |
| SMILES | COC(=O)/C=C/C(=O)OCC(C)(C)[C@@H](O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H19NO8/c1-13(2,11(19)12(20)14-6-8(15)16)7-22-10(18)5-4-9(17)21-3/h4-5,11,19H,6-7H2,1-3H3,(H,14,20)(H,15,16)/b5-4+/t11-/m0/s1 |
| InChIKey | JLAPGTYGLFWFLE-ZWNMCFTASA-N |
| XLogP | -1.15 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|