C15H23NO7 — CID 122667391
4-O-[(3R)-3-hydroxy-2,2-dimethyl-4-morpholin-4-yl-4-oxobutyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122667391) has the molecular formula C15H23NO7 and a molecular weight of 329.35 g/mol. Its IUPAC name is 4-O-[(3R)-3-hydroxy-2,2-dimethyl-4-morpholin-4-yl-4-oxobutyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(3R)-3-hydroxy-2,2-dimethyl-4-morpholin-4-yl-4-oxobutyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122667391 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-O-[(3R)-3-hydroxy-2,2-dimethyl-4-morpholin-4-yl-4-oxobutyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(C)(C)[C@@H](O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H23NO7/c1-15(2,10-23-12(18)5-4-11(17)21-3)13(19)14(20)16-6-8-22-9-7-16/h4-5,13,19H,6-10H2,1-3H3/b5-4+/t13-/m0/s1 |
| InChIKey | NVFMEEIHFPIYBP-IHVVCDCBSA-N |
| XLogP | -0.50 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|