C13H19NO7 — CID 122667400
1-O-ethyl 4-O-(2-hydroxy-3-morpholin-4-yl-3-oxopropyl) (E)-but-2-enedioate (PubChem CID 122667400) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(2-hydroxy-3-morpholin-4-yl-3-oxopropyl) (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-(2-hydroxy-3-morpholin-4-yl-3-oxopropyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122667400 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-O-ethyl 4-O-(2-hydroxy-3-morpholin-4-yl-3-oxopropyl) (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H19NO7/c1-2-20-11(16)3-4-12(17)21-9-10(15)13(18)14-5-7-19-8-6-14/h3-4,10,15H,2,5-9H2,1H3/b4-3+ |
| InChIKey | AGIALNCFTOONBE-ONEGZZNKSA-N |
| XLogP | -1.13 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|