C15H23NO6 — CID 122664258
1-O-(2-hydroxy-3-oxo-3-piperidin-1-ylpropyl) 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 122664258) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-O-(2-hydroxy-3-oxo-3-piperidin-1-ylpropyl) 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-(2-hydroxy-3-oxo-3-piperidin-1-ylpropyl) 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122664258 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-O-(2-hydroxy-3-oxo-3-piperidin-1-ylpropyl) 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CC(C)OC(=O)/C=C/C(=O)OCC(O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H23NO6/c1-11(2)22-14(19)7-6-13(18)21-10-12(17)15(20)16-8-4-3-5-9-16/h6-7,11-12,17H,3-5,8-10H2,1-2H3/b7-6+ |
| InChIKey | IUQYTGYLRFUALT-VOTSOKGWSA-N |
| XLogP | 0.41 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|