C13H19NO6 — CID 122664242
4-O-[(2S)-2-hydroxy-3-oxo-3-piperidin-1-ylpropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122664242) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-O-[(2S)-2-hydroxy-3-oxo-3-piperidin-1-ylpropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2S)-2-hydroxy-3-oxo-3-piperidin-1-ylpropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122664242 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-O-[(2S)-2-hydroxy-3-oxo-3-piperidin-1-ylpropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC[C@H](O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H19NO6/c1-19-11(16)5-6-12(17)20-9-10(15)13(18)14-7-3-2-4-8-14/h5-6,10,15H,2-4,7-9H2,1H3/b6-5+/t10-/m0/s1 |
| InChIKey | YAAMZZFBTZHVTM-PORFMDCZSA-N |
| XLogP | -0.37 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|