C9H13NO6 — CID 122664243
4-O-[2-hydroxy-3-(methylamino)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122664243) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is 4-O-[2-hydroxy-3-(methylamino)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-hydroxy-3-(methylamino)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122664243 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-O-[2-hydroxy-3-(methylamino)-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | CNC(=O)C(O)COC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C9H13NO6/c1-10-9(14)6(11)5-16-8(13)4-3-7(12)15-2/h3-4,6,11H,5H2,1-2H3,(H,10,14)/b4-3+ |
| InChIKey | HZUAVINPSGWNKW-ONEGZZNKSA-N |
| XLogP | -1.63 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|