C14H16O5 — CID 54428904
4-O-(2-hydroxy-3-phenylpropyl) 1-O-methyl but-2-enedioate (PubChem CID 54428904) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-O-(2-hydroxy-3-phenylpropyl) 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-(2-hydroxy-3-phenylpropyl) 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 54428904 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-O-(2-hydroxy-3-phenylpropyl) 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C14H16O5/c1-18-13(16)7-8-14(17)19-10-12(15)9-11-5-3-2-4-6-11/h2-8,12,15H,9-10H2,1H3 |
| InChIKey | WGCDRVZQUVUYSM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|