C28H38N2O8S2 — CID 126492759
bis[(2S)-3-phenyl-2-(propan-2-ylsulfonylamino)propyl] (E)-but-2-enedioate (PubChem CID 126492759) has the molecular formula C28H38N2O8S2 and a molecular weight of 594.75 g/mol. Its IUPAC name is bis[(2S)-3-phenyl-2-(propan-2-ylsulfonylamino)propyl] (E)-but-2-enedioate.
| Compound Name | bis[(2S)-3-phenyl-2-(propan-2-ylsulfonylamino)propyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126492759 |
| Molecular Formula | C28H38N2O8S2 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | bis[(2S)-3-phenyl-2-(propan-2-ylsulfonylamino)propyl] (E)-but-2-enedioate |
| SMILES | CC(C)S(=O)(=O)N[C@H](COC(=O)/C=C/C(=O)OC[C@H](Cc1ccccc1)NS(=O)(=O)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C28H38N2O8S2/c1-21(2)39(33,34)29-25(17-23-11-7-5-8-12-23)19-37-27(31)15-16-28(32)38-20-26(30-40(35,36)22(3)4)18-24-13-9-6-10-14-24/h5-16,21-22,25-26,29-30H,17-20H2,1-4H3/b16-15+/t25-,26-/m0/s1 |
| InChIKey | SFTNBKQFUHPVRZ-ISIDIFJPSA-N |
| XLogP | 2.51 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|