C34H34N2O8S2 — CID 126492735
bis[(2R)-2-(benzylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate (PubChem CID 126492735) has the molecular formula C34H34N2O8S2 and a molecular weight of 662.79 g/mol. Its IUPAC name is bis[(2R)-2-(benzylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate.
| Compound Name | bis[(2R)-2-(benzylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126492735 |
| Molecular Formula | C34H34N2O8S2 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | bis[(2R)-2-(benzylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OC[C@H](NS(=O)(=O)Cc1ccccc1)c1ccccc1)OC[C@H](NS(=O)(=O)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34N2O8S2/c37-33(43-23-31(29-17-9-3-10-18-29)35-45(39,40)25-27-13-5-1-6-14-27)21-22-34(38)44-24-32(30-19-11-4-12-20-30)36-46(41,42)26-28-15-7-2-8-16-28/h1-22,31-32,35-36H,23-26H2/b22-21+/t31-,32-/m0/s1 |
| InChIKey | ICFFMKFYXIFEMJ-QFDKVFPNSA-N |
| XLogP | 4.35 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|