C17H21NO5 — CID 126483243
1-O-methyl 4-O-[(2R)-2-(2-methylpropanoylamino)-2-phenylethyl] (E)-but-2-enedioate (PubChem CID 126483243) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2R)-2-(2-methylpropanoylamino)-2-phenylethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(2R)-2-(2-methylpropanoylamino)-2-phenylethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126483243 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-O-methyl 4-O-[(2R)-2-(2-methylpropanoylamino)-2-phenylethyl] (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC[C@H](NC(=O)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H21NO5/c1-12(2)17(21)18-14(13-7-5-4-6-8-13)11-23-16(20)10-9-15(19)22-3/h4-10,12,14H,11H2,1-3H3,(H,18,21)/b10-9+/t14-/m0/s1 |
| InChIKey | ODQZWXBVPOBHRB-HBWSCVEGSA-N |
| XLogP | 1.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|