C20H29NO6S — CID 126491760
1-O-[2-(2,2-dimethylpropylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 126491760) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylpropylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-[2-(2,2-dimethylpropylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126491760 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-O-[2-(2,2-dimethylpropylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CC(C)OC(=O)/C=C/C(=O)OCC(NS(=O)(=O)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H29NO6S/c1-15(2)27-19(23)12-11-18(22)26-13-17(16-9-7-6-8-10-16)21-28(24,25)14-20(3,4)5/h6-12,15,17,21H,13-14H2,1-5H3/b12-11+ |
| InChIKey | SBDWXDCSARWESK-VAWYXSNFSA-N |
| XLogP | 2.74 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|