C22H31NO6S — CID 126491747
1-O-[2-(cyclohexylmethylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 126491747) has the molecular formula C22H31NO6S and a molecular weight of 437.56 g/mol. Its IUPAC name is 1-O-[2-(cyclohexylmethylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-[2-(cyclohexylmethylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126491747 |
| Molecular Formula | C22H31NO6S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-O-[2-(cyclohexylmethylsulfonylamino)-2-phenylethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CC(C)OC(=O)/C=C/C(=O)OCC(NS(=O)(=O)CC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C22H31NO6S/c1-17(2)29-22(25)14-13-21(24)28-15-20(19-11-7-4-8-12-19)23-30(26,27)16-18-9-5-3-6-10-18/h4,7-8,11-14,17-18,20,23H,3,5-6,9-10,15-16H2,1-2H3/b14-13+ |
| InChIKey | OOKLDUSCZPWUCE-BUHFOSPRSA-N |
| XLogP | 3.28 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|