C32H42N2O8S2 — CID 126496956
bis[(2S)-2-(cyclohexylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate (PubChem CID 126496956) has the molecular formula C32H42N2O8S2 and a molecular weight of 646.83 g/mol. Its IUPAC name is bis[(2S)-2-(cyclohexylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate.
| Compound Name | bis[(2S)-2-(cyclohexylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126496956 |
| Molecular Formula | C32H42N2O8S2 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | bis[(2S)-2-(cyclohexylsulfonylamino)-2-phenylethyl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OC[C@@H](NS(=O)(=O)C1CCCCC1)c1ccccc1)OC[C@@H](NS(=O)(=O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C32H42N2O8S2/c35-31(41-23-29(25-13-5-1-6-14-25)33-43(37,38)27-17-9-3-10-18-27)21-22-32(36)42-24-30(26-15-7-2-8-16-26)34-44(39,40)28-19-11-4-12-20-28/h1-2,5-8,13-16,21-22,27-30,33-34H,3-4,9-12,17-20,23-24H2/b22-21+/t29-,30-/m1/s1 |
| InChIKey | GZOPAPIOJIGKFA-LHZXLWIGSA-N |
| XLogP | 4.62 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|