C13H18BrNO4S2 — CID 114296825
N-(2-bromo-1-phenylethyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 114296825) has the molecular formula C13H18BrNO4S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is N-(2-bromo-1-phenylethyl)-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-(2-bromo-1-phenylethyl)-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 114296825 |
| Molecular Formula | C13H18BrNO4S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | N-(2-bromo-1-phenylethyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NC(CBr)c2ccccc2)CC1 |
| InChI | InChI=1S/C13H18BrNO4S2/c14-10-13(11-4-2-1-3-5-11)15-21(18,19)12-6-8-20(16,17)9-7-12/h1-5,12-13,15H,6-10H2 |
| InChIKey | USVYJTONXKXQLB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|