C13H20N2O4S2 — CID 62950640
N-[[2-(aminomethyl)phenyl]methyl]-1,1-dioxothiane-4-sulfonamide (PubChem CID 62950640) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-[[2-(aminomethyl)phenyl]methyl]-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62950640 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-[[2-(aminomethyl)phenyl]methyl]-1,1-dioxothiane-4-sulfonamide |
| SMILES | NCc1ccccc1CNS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H20N2O4S2/c14-9-11-3-1-2-4-12(11)10-15-21(18,19)13-5-7-20(16,17)8-6-13/h1-4,13,15H,5-10,14H2 |
| InChIKey | WZGGFHIZSNBBRX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |