C12H16BrNO4S2 — CID 62086018
N-[(3-bromophenyl)methyl]-1,1-dioxothiane-4-sulfonamide (PubChem CID 62086018) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1,1-dioxothiane-4-sulfonamide.
| Compound Name | N-[(3-bromophenyl)methyl]-1,1-dioxothiane-4-sulfonamide |
|---|---|
| PubChem CID | 62086018 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C12H16BrNO4S2/c13-11-3-1-2-10(8-11)9-14-20(17,18)12-4-6-19(15,16)7-5-12/h1-3,8,12,14H,4-7,9H2 |
| InChIKey | RIMNUPJPGIPHFM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |