C11H15NO4S2 — CID 7068858
(3R)-N-benzyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 7068858) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (3R)-N-benzyl-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | (3R)-N-benzyl-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 7068858 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | (3R)-N-benzyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CC[C@@H](S(=O)(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C11H15NO4S2/c13-17(14)7-6-11(9-17)18(15,16)12-8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-/m1/s1 |
| InChIKey | GMCFFZYHAXAPGE-LLVKDONJSA-N |
| XLogP | 0.29 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |