C11H15NO4S2 — CID 40548256
(3R)-N-(2-methylphenyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 40548256) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (3R)-N-(2-methylphenyl)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | (3R)-N-(2-methylphenyl)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 40548256 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | (3R)-N-(2-methylphenyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | Cc1ccccc1NS(=O)(=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15NO4S2/c1-9-4-2-3-5-11(9)12-18(15,16)10-6-7-17(13,14)8-10/h2-5,10,12H,6-8H2,1H3/t10-/m1/s1 |
| InChIKey | LXBREDCZHTTXTG-SNVBAGLBSA-N |
| XLogP | 0.92 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |