C10H13NO5S2 — CID 3738067
N-(3-hydroxyphenyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 3738067) has the molecular formula C10H13NO5S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-(3-hydroxyphenyl)-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 3738067 |
| Molecular Formula | C10H13NO5S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | N-(3-hydroxyphenyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2cccc(O)c2)C1 |
| InChI | InChI=1S/C10H13NO5S2/c12-9-3-1-2-8(6-9)11-18(15,16)10-4-5-17(13,14)7-10/h1-3,6,10-12H,4-5,7H2 |
| InChIKey | UWMYNXMODVDRJK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |