C17H18ClNO5S2 — CID 20995143
N-[4-[(4-chlorophenyl)methoxy]phenyl]-1,1-dioxothiolane-3-sulfonamide (PubChem CID 20995143) has the molecular formula C17H18ClNO5S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methoxy]phenyl]-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 20995143 |
| Molecular Formula | C17H18ClNO5S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2ccc(OCc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C17H18ClNO5S2/c18-14-3-1-13(2-4-14)11-24-16-7-5-15(6-8-16)19-26(22,23)17-9-10-25(20,21)12-17/h1-8,17,19H,9-12H2 |
| InChIKey | IRHJNJOKTHLNEE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |