C24H23N3O4S2 — CID 123858661
N-[4-(1-benzylbenzimidazol-2-yl)phenyl]-1,1-dioxothiolane-3-sulfonamide (PubChem CID 123858661) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[4-(1-benzylbenzimidazol-2-yl)phenyl]-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N-[4-(1-benzylbenzimidazol-2-yl)phenyl]-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 123858661 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[4-(1-benzylbenzimidazol-2-yl)phenyl]-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)Nc2ccc(-c3nc4ccccc4n3Cc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C24H23N3O4S2/c28-32(29)15-14-21(17-32)33(30,31)26-20-12-10-19(11-13-20)24-25-22-8-4-5-9-23(22)27(24)16-18-6-2-1-3-7-18/h1-13,21,26H,14-17H2 |
| InChIKey | QUDGXGZVINMZTN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |