About N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine
N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine (PubChem CID 131929446) has the molecular formula C22H27N3O2S
and a molecular weight of 397.54 g/mol. Its IUPAC name is N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine |
| PubChem CID | 131929446 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCN(Cc1nc2ccccc2n1Cc1ccc(C)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H27N3O2S/c1-3-24(19-12-13-28(26,27)16-19)15-22-23-20-6-4-5-7-21(20)25(22)14-18-10-8-17(2)9-11-18/h4-11,19H,3,12-16H2,1-2H3 |
| InChIKey | WJPWCKGCNPQGAN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine?
The IUPAC name of N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine (CID 131929446) is N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine is CCN(Cc1nc2ccccc2n1Cc1ccc(C)cc1)C1CCS(=O)(=O)C1.
What is the InChIKey of N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine?
The InChIKey is WJPWCKGCNPQGAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O2S/c1-3-24(19-12-13-28(26,27)16-19)15-22-23-20-6-4-5-7-21(20)25(22)14-18-10-8-17(2)9-11-18/h4-11,19H,3,12-16H2,1-2H3.
What are the key properties of N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine?
N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine has a molecular weight of 397.54 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]methyl]-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 131929446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).