C14H18N2O2S — CID 116626981
3-(2-propylbenzimidazol-1-yl)thiolane 1,1-dioxide (PubChem CID 116626981) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-(2-propylbenzimidazol-1-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(2-propylbenzimidazol-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 116626981 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(2-propylbenzimidazol-1-yl)thiolane 1,1-dioxide |
| SMILES | CCCc1nc2ccccc2n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18N2O2S/c1-2-5-14-15-12-6-3-4-7-13(12)16(14)11-8-9-19(17,18)10-11/h3-4,6-7,11H,2,5,8-10H2,1H3 |
| InChIKey | GBVDKFWFCJRQAK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |