C13H17N3O2S — CID 63636344
2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanamine (PubChem CID 63636344) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanamine.
| Compound Name | 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 63636344 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanamine |
| SMILES | NCCc1nc2ccccc2n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17N3O2S/c14-7-5-13-15-11-3-1-2-4-12(11)16(13)10-6-8-19(17,18)9-10/h1-4,10H,5-9,14H2 |
| InChIKey | XWGACGGVVFLJNX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |