C11H12N2O2S — CID 139266953
3-(2-methylbenzimidazol-1-yl)thietane 1,1-dioxide (PubChem CID 139266953) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-(2-methylbenzimidazol-1-yl)thietane 1,1-dioxide.
| Compound Name | 3-(2-methylbenzimidazol-1-yl)thietane 1,1-dioxide |
|---|---|
| PubChem CID | 139266953 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(2-methylbenzimidazol-1-yl)thietane 1,1-dioxide |
| SMILES | Cc1nc2ccccc2n1C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C11H12N2O2S/c1-8-12-10-4-2-3-5-11(10)13(8)9-6-16(14,15)7-9/h2-5,9H,6-7H2,1H3 |
| InChIKey | SRCPXPSJLFZDPQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |