C13H16ClN3O2S — CID 81135449
3-[2-(2-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiolane 1,1-dioxide (PubChem CID 81135449) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 3-[2-(2-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[2-(2-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 81135449 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-[2-(2-chloroethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]thiolane 1,1-dioxide |
| SMILES | Cc1ccc2nc(CCCl)n(C3CCS(=O)(=O)C3)c2n1 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-9-2-3-11-13(15-9)17(12(16-11)4-6-14)10-5-7-20(18,19)8-10/h2-3,10H,4-8H2,1H3 |
| InChIKey | GBRSKOHWJDVCCT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|