C12H17ClN4O2S — CID 79297793
3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiolane 1,1-dioxide (PubChem CID 79297793) has the molecular formula C12H17ClN4O2S and a molecular weight of 316.81 g/mol. Its IUPAC name is 3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79297793 |
| Molecular Formula | C12H17ClN4O2S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-[5-(2-chloroethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiolane 1,1-dioxide |
| SMILES | Cc1nn(C)c2c1nc(CCCl)n2C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17ClN4O2S/c1-8-11-12(16(2)15-8)17(10(14-11)3-5-13)9-4-6-20(18,19)7-9/h9H,3-7H2,1-2H3 |
| InChIKey | SQUBTTIDDZVIEN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|