C12H14ClN3O2S — CID 79294395
3-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide (PubChem CID 79294395) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide.
| Compound Name | 3-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 79294395 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(n2c(CCl)nc3cccnc32)C1 |
| InChI | InChI=1S/C12H14ClN3O2S/c13-7-11-15-10-4-1-5-14-12(10)16(11)9-3-2-6-19(17,18)8-9/h1,4-5,9H,2-3,6-8H2 |
| InChIKey | QBCSAWGETAKJDG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|