C19H21ClN4 — CID 97166664
3-[(3R)-1-benzylpiperidin-3-yl]-2-(chloromethyl)imidazo[4,5-b]pyridine (PubChem CID 97166664) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is 3-[(3R)-1-benzylpiperidin-3-yl]-2-(chloromethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-[(3R)-1-benzylpiperidin-3-yl]-2-(chloromethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 97166664 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[(3R)-1-benzylpiperidin-3-yl]-2-(chloromethyl)imidazo[4,5-b]pyridine |
| SMILES | ClCc1nc2cccnc2n1[C@@H]1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H21ClN4/c20-12-18-22-17-9-4-10-21-19(17)24(18)16-8-5-11-23(14-16)13-15-6-2-1-3-7-15/h1-4,6-7,9-10,16H,5,8,11-14H2/t16-/m1/s1 |
| InChIKey | BQITYXQICRMMBY-MRXNPFEDSA-N |
| XLogP | 4.01 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|