C13H18N4 — CID 82474489
(3-cyclohexylimidazo[4,5-b]pyridin-2-yl)methanamine (PubChem CID 82474489) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is (3-cyclohexylimidazo[4,5-b]pyridin-2-yl)methanamine.
| Compound Name | (3-cyclohexylimidazo[4,5-b]pyridin-2-yl)methanamine |
|---|---|
| PubChem CID | 82474489 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (3-cyclohexylimidazo[4,5-b]pyridin-2-yl)methanamine |
| SMILES | NCc1nc2cccnc2n1C1CCCCC1 |
| InChI | InChI=1S/C13H18N4/c14-9-12-16-11-7-4-8-15-13(11)17(12)10-5-2-1-3-6-10/h4,7-8,10H,1-3,5-6,9,14H2 |
| InChIKey | UHTINIHVGWSYKR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |