C15H22N4 — CID 82483690
2-(3-cycloheptylimidazo[4,5-b]pyridin-2-yl)ethanamine (PubChem CID 82483690) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-(3-cycloheptylimidazo[4,5-b]pyridin-2-yl)ethanamine.
| Compound Name | 2-(3-cycloheptylimidazo[4,5-b]pyridin-2-yl)ethanamine |
|---|---|
| PubChem CID | 82483690 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-(3-cycloheptylimidazo[4,5-b]pyridin-2-yl)ethanamine |
| SMILES | NCCc1nc2cccnc2n1C1CCCCCC1 |
| InChI | InChI=1S/C15H22N4/c16-10-9-14-18-13-8-5-11-17-15(13)19(14)12-6-3-1-2-4-7-12/h5,8,11-12H,1-4,6-7,9-10,16H2 |
| InChIKey | WJTATEWFKUEUOE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |