C14H19N3S — CID 117165693
2-propyl-3-(thian-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117165693) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-propyl-3-(thian-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 2-propyl-3-(thian-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117165693 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-propyl-3-(thian-3-yl)imidazo[4,5-b]pyridine |
| SMILES | CCCc1nc2cccnc2n1C1CCCSC1 |
| InChI | InChI=1S/C14H19N3S/c1-2-5-13-16-12-7-3-8-15-14(12)17(13)11-6-4-9-18-10-11/h3,7-8,11H,2,4-6,9-10H2,1H3 |
| InChIKey | GMGPJWQUCWZYIU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |