C13H17N3O2S — CID 117165614
4-(2-ethylimidazo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide (PubChem CID 117165614) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-(2-ethylimidazo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide.
| Compound Name | 4-(2-ethylimidazo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117165614 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-(2-ethylimidazo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide |
| SMILES | CCc1nc2cccnc2n1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H17N3O2S/c1-2-12-15-11-4-3-7-14-13(11)16(12)10-5-8-19(17,18)9-6-10/h3-4,7,10H,2,5-6,8-9H2,1H3 |
| InChIKey | RXFOOLKIVWNDRH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |