C13H15N3O2 — CID 79474872
ethyl 2-(3-cyclopropylimidazo[4,5-b]pyridin-2-yl)acetate (PubChem CID 79474872) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 2-(3-cyclopropylimidazo[4,5-b]pyridin-2-yl)acetate.
| Compound Name | ethyl 2-(3-cyclopropylimidazo[4,5-b]pyridin-2-yl)acetate |
|---|---|
| PubChem CID | 79474872 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | ethyl 2-(3-cyclopropylimidazo[4,5-b]pyridin-2-yl)acetate |
| SMILES | CCOC(=O)Cc1nc2cccnc2n1C1CC1 |
| InChI | InChI=1S/C13H15N3O2/c1-2-18-12(17)8-11-15-10-4-3-7-14-13(10)16(11)9-5-6-9/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | YBMIUYPUQLCDNE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |